![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
.png){kind=link}
![[ ]](/icons/unknown.gif){kind=icon}
.webp){kind=link}
.jpeg){kind=link}
.jpeg){kind=link}
.jpeg){kind=link}
.jpeg){kind=link}
.jpeg){kind=link}
.webp){kind=link}
.webp){kind=link}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 00.png | 2025-05-14 14:12 | 111K | |
| 26 (1).png | 2025-05-19 13:28 | 513K | |
| 71N1udQE5tL._AC_UF89..> | 2025-05-08 13:42 | 76K | |
| 17424532493404275407..> | 2025-05-08 15:21 | 31K | |
| Ab Wheels 1.jpg | 2025-05-09 17:59 | 6.5K | |
| Ab Wheels 2.jpg | 2025-05-09 18:05 | 8.6K | |
| Ab Wheels 3.jpg | 2025-05-09 18:01 | 9.1K | |
| Ab Wheels 4.jpg | 2025-05-09 18:04 | 10K | |
| Adjustable Dumbbells..> | 2025-05-09 18:16 | 6.7K | |
| Adjustable Dumbbells..> | 2025-05-09 18:17 | 7.2K | |
| Adjustable Dumbbells..> | 2025-05-22 11:33 | 7.2K | |
| Agility Ladder Train..> | 2025-05-22 11:03 | 7.8K | |
| Anti-Slip Yoga Balls..> | 2025-05-09 18:15 | 7.0K | |
| Anti-Slip Yoga Balls..> | 2025-05-09 18:12 | 8.0K | |
| Anti-Slip Yoga Balls..> | 2025-05-09 18:13 | 9.5K | |
| Arm Band 1.jpg | 2025-05-22 15:48 | 9.3K | |
| Arm Band 3.jpg | 2025-05-10 12:03 | 6.3K | |
| Baby Mosquito Net wi..> | 2025-05-08 15:51 | 60K | |
| Baby Mosquito Net wi..> | 2025-05-08 15:28 | 7.8K | |
| Baby Mosquito Net wi..> | 2025-05-08 15:39 | 5.3K | |
| Baby Mosquito Net wi..> | 2025-05-08 15:31 | 4.2K | |
| Baby Mosquito Net wi..> | 2025-05-08 15:33 | 7.8K | |
| Bed Linens.jpg | 2025-05-08 16:24 | 5.2K | |
| Bed Linens 1.jpg | 2025-05-08 16:13 | 7.2K | |
| Bed Linens 2.jpg | 2025-05-08 16:15 | 6.6K | |
| Bed Linens 4.jpg | 2025-05-08 16:22 | 7.3K | |
| Bed Linens 6.jpg | 2025-05-08 16:26 | 7.9K | |
| Bed Sheets.jpg | 2025-05-08 16:27 | 14K | |
| Bed Sheets1.jpg | 2025-05-08 16:49 | 9.6K | |
| Bed Sheets3.jpg | 2025-05-08 16:45 | 10K | |
| Bed Sheets6.jpg | 2025-05-08 16:47 | 8.9K | |
| Bike Pedal Exerciser..> | 2025-05-09 18:32 | 7.4K | |
| Bike Pedal Exerciser..> | 2025-05-09 18:33 | 6.0K | |
| Bike Pedal Exerciser..> | 2025-05-09 18:42 | 9.8K | |
| Bike Pedal Exerciser..> | 2025-05-09 18:44 | 10K | |
| Blankets.jpg | 2025-05-08 16:50 | 10K | |
| Blankets1.jpg | 2025-05-08 16:51 | 7.3K | |
| Blankets2.jpg | 2025-05-08 16:57 | 7.3K | |
| Blankets5.jpg | 2025-05-08 17:00 | 5.4K | |
| Blankets6.jpg | 2025-05-08 17:03 | 7.7K | |
| Calf Stretcher Rocke..> | 2025-05-09 18:07 | 7.0K | |
| Calf Stretcher Rocke..> | 2025-05-09 18:08 | 8.8K | |
| Calf Stretcher Rocke..> | 2025-05-09 18:09 | 8.7K | |
| Calf Stretcher Rocke..> | 2025-05-09 18:10 | 8.7K | |
| Clipped_image_202503..> | 2025-05-08 15:50 | 905K | |
| Clipped_image_202503..> | 2025-05-08 15:53 | 785K | |
| Clipped_image_202503..> | 2025-05-08 15:58 | 2.0M | |
| Clipped_image_202503..> | 2025-05-08 16:11 | 1.3M | |
| Clipped_image_202503..> | 2025-05-08 16:08 | 1.1M | |
| Clipped_image_202503..> | 2025-05-08 16:05 | 898K | |
| Clipped_image_202503..> | 2025-05-08 16:02 | 844K | |
| Clipped_image_202503..> | 2025-05-08 16:00 | 805K | |
| Concealer 1.jpg | 2025-05-22 12:46 | 5.1K | |
| Curtains.jpg | 2025-05-08 17:04 | 11K | |
| Curtains1.jpg | 2025-05-08 17:25 | 7.3K | |
| Curtains2.jpg | 2025-05-08 17:29 | 8.7K | |
| Curtains3.jpg | 2025-05-08 17:30 | 11K | |
| Curtains6.jpg | 2025-05-08 17:32 | 8.0K | |
| Cushions & Pillows.jpg | 2025-05-08 17:34 | 8.6K | |
| Cushions & Pillows2.jpg | 2025-05-08 17:36 | 8.0K | |
| Cushions & Pillows4.jpg | 2025-05-08 17:38 | 5.9K | |
| Cushions & Pillows5.jpg | 2025-05-08 17:42 | 5.6K | |
| Cushions & Pillows6.jpg | 2025-05-08 17:42 | 8.3K | |
| D1.png | 2025-05-21 14:09 | 65K | |
| D2.png | 2025-05-21 14:11 | 65K | |
| D3.png | 2025-05-21 14:15 | 66K | |
| D4.png | 2025-05-21 14:17 | 62K | |
| Darwin-collection-th..> | 2025-05-08 17:57 | 20K | |
| Dupatta.jpg | 2025-05-21 12:53 | 8.4K | |
| Dupatta.png | 2025-05-21 12:50 | 49K | |
| Dupatta3.jpg | 2025-05-21 12:58 | 8.6K | |
| Exercise Mats.jpg | 2025-05-09 16:02 | 4.6K | |
| Exercise Mats 2.jpg | 2025-05-09 16:03 | 5.0K | |
| Exercise Mats 3.jpg | 2025-05-09 16:05 | 3.5K | |
| Exercise Mats 4.jpg | 2025-05-09 16:11 | 6.2K | |
| Eye Liners 4.jpg | 2025-05-22 13:47 | 3.8K | |
| Fitness Apparel 1.jpg | 2025-05-09 15:49 | 6.9K | |
| Fitness Apparel 2.jpg | 2025-05-09 15:50 | 12K | |
| Fitness Apparel 3.jpg | 2025-05-09 15:51 | 12K | |
| Fitness Apparel 4.jpg | 2025-05-09 15:53 | 12K | |
| Hand Grip Strengthen..> | 2025-05-22 11:25 | 5.3K | |
| Highlighter 1.jpg | 2025-05-22 12:44 | 13K | |
| Insulated Water Bott..> | 2025-05-09 18:46 | 7.2K | |
| Insulated Water Bott..> | 2025-05-09 18:47 | 4.7K | |
| Insulated Water Bott..> | 2025-05-09 18:49 | 6.8K | |
| Insulated Water Bott..> | 2025-05-09 18:50 | 4.2K | |
| Jump Rope 1.jpg | 2025-05-09 18:25 | 8.8K | |
| Jump Rope 2.jpg | 2025-05-09 18:23 | 8.0K | |
| Jump Rope 3.jpg | 2025-05-09 18:22 | 8.0K | |
| Jump Rope 4.jpg | 2025-05-22 11:17 | 5.3K | |
| Kajol 4.jpg | 2025-05-22 13:37 | 2.6K | |
| Kick Board 3.jpg | 2025-05-22 16:28 | 12K | |
| Kuruti.jpg | 2025-05-20 17:08 | 7.1K | |
| Lipsticks & Liners.png | 2025-05-21 15:55 | 16K | |
| Mask and Facial Kits..> | 2025-05-10 12:45 | 3.7K | |
| Mosquito Net.avif | 2025-05-08 12:45 | 51K | |
| Mosquito Net.webp | 2025-05-08 12:27 | 99K | |
| Nose Clip 1.jpg | 2025-05-10 11:58 | 5.7K | |
| Nose Clip 4.jpg | 2025-05-22 16:10 | 7.2K | |
| Patieyla.jpg | 2025-05-21 12:43 | 39K | |
| Pull-Up Bar 1.jpg | 2025-05-09 17:48 | 5.5K | |
| Pull-Up Bar 2.jpg | 2025-05-09 17:50 | 10K | |
| Pull-Up Bar 3.jpg | 2025-05-09 17:57 | 4.7K | |
| Pull Buoy 1.jpg | 2025-05-10 12:01 | 8.7K | |
| Pull Buoy 2.jpg | 2025-05-22 15:57 | 3.8K | |
| Pull Buoy3.jpg | 2025-05-22 16:50 | 5.9K | |
| Pull Buoy 4.jpg | 2025-05-22 16:49 | 4.2K | |
| Push Up Rack Boards ..> | 2025-05-09 17:21 | 6.8K | |
| Push Up Rack Boards ..> | 2025-05-09 17:38 | 9.4K | |
| Push Up Rack Boards ..> | 2025-05-09 17:35 | 6.4K | |
| Push Up Rack Boards ..> | 2025-05-09 17:36 | 5.7K | |
| Resistance Bands 1.jpg | 2025-05-09 15:40 | 10K | |
| Resistance Bands 2.jpg | 2025-05-09 15:46 | 9.0K | |
| Resistance Bands 3.png | 2025-05-09 15:45 | 46K | |
| Resistance Bands 4.jpg | 2025-05-09 15:47 | 8.9K | |
| Serums 1.jpg | 2025-05-10 12:41 | 4.4K | |
| Smartwatches 1.jpg | 2025-05-09 17:43 | 11K | |
| Smartwatches 2.jpg | 2025-05-09 17:41 | 6.9K | |
| Smartwatches 3.jpg | 2025-05-09 17:45 | 8.7K | |
| Smartwatches 4.jpg | 2025-05-09 17:46 | 6.5K | |
| Snorkel 1.jpg | 2025-05-10 12:02 | 8.2K | |
| Snorkel 2.jpg | 2025-05-22 15:50 | 8.7K | |
| Snorkel 3.png | 2025-05-22 16:47 | 50K | |
| Swim Costume Men 2.jpg | 2025-05-22 16:26 | 3.3K | |
| Swim Googles 1.jpg | 2025-05-10 12:00 | 5.5K | |
| Swim Googles 2.jpg | 2025-05-22 16:54 | 6.8K | |
| Swim Googles 4.jpg | 2025-05-22 16:08 | 4.9K | |
| Swim Leggings 1.jpg | 2025-05-22 15:42 | 3.3K | |
| Swim Leggings 2.jpg | 2025-05-22 16:43 | 4.4K | |
| Swim Leggings 3.jpg | 2025-05-10 12:05 | 5.1K | |
| Swim Leggings 4.jpg | 2025-05-22 16:44 | 4.0K | |
| Swimming Earplug 1.jpg | 2025-05-22 16:31 | 5.1K | |
| Swimming Earplug 3.jpg | 2025-05-10 11:38 | 4.6K | |
| Swimming Paddle 1.jpg | 2025-05-22 16:03 | 6.4K | |
| Swimming Paddle 4.jpg | 2025-05-22 16:05 | 4.2K | |
| Training Bags (1).webp | 2025-05-21 18:44 | 21K | |
| Training Bags.webp | 2025-05-21 18:42 | 21K | |
| Training Bags 1.jpg | 2025-05-19 12:28 | 5.0K | |
| Tshirt.jpg | 2025-05-20 18:44 | 3.1K | |
| Vitamins and Supplem..> | 2025-05-09 18:26 | 6.4K | |
| Vitamins and Supplem..> | 2025-05-09 18:30 | 6.6K | |
| Vitamins and Supplem..> | 2025-05-09 18:29 | 6.6K | |
| Weighing Scales 1.jpg | 2025-05-09 15:54 | 8.1K | |
| Weighing Scales 2.jpg | 2025-05-09 16:01 | 4.9K | |
| Weighing Scales 3.jpg | 2025-05-09 16:00 | 4.8K | |
| Weighing Scales 4.jpg | 2025-05-09 15:57 | 3.4K | |
| Weighted Fitness Hoo..> | 2025-05-22 11:30 | 19K | |
| Weighted Fitness Hoo..> | 2025-05-09 18:52 | 8.3K | |
| Weighted Fitness Hoo..> | 2025-05-09 18:53 | 7.0K | |
| Weighted Fitness Hoo..> | 2025-05-09 18:56 | 4.1K | |
| WhatsApp Image 2025-..> | 2025-05-19 12:37 | 132K | |
| WhatsApp Image 2025-..> | 2025-05-19 12:40 | 132K | |
| WhatsApp Image 2025-..> | 2025-05-19 12:35 | 45K | |
| Women’s Winter Col..> | 2025-05-21 12:31 | 54K | |
| Yoga Blocks and Roll..> | 2025-05-09 17:13 | 8.3K | |
| Yoga Blocks and Roll..> | 2025-05-09 17:15 | 3.6K | |
| Yoga Blocks and Roll..> | 2025-05-09 17:17 | 5.1K | |
| Yoga Blocks and Roll..> | 2025-05-09 17:19 | 8.6K | |
| baby mosquite net.jpg | 2025-05-08 14:13 | 3.1K | |
| baby mosquitw net.jpg | 2025-05-08 15:25 | 9.3K | |
| blaser.png | 2025-05-20 16:39 | 19K | |
| blaser1.jpg | 2025-05-20 16:41 | 5.0K | |
| blaser2.jpg | 2025-05-20 16:44 | 6.0K | |
| blazer.jpg | 2025-05-10 13:18 | 4.3K | |
| blouse.jpg | 2025-05-21 13:05 | 5.4K | |
| blouse1.jpg | 2025-05-21 13:04 | 5.9K | |
| blouse4.jpg | 2025-05-10 12:59 | 13K | |
| blouse5.jpg | 2025-05-21 13:07 | 46K | |
| casual.jpg | 2025-05-20 18:38 | 8.1K | |
| casual2.jpg | 2025-05-21 11:46 | 5.6K | |
| casual3.jpg | 2025-05-20 18:40 | 5.1K | |
| category-12.png | 2025-05-08 18:03 | 82K | |
| compact 1.jpg | 2025-05-21 18:00 | 6.9K | |
| compact 4.jpg | 2025-05-21 18:31 | 5.4K | |
| conceler 2.jpg | 2025-05-22 12:37 | 3.6K | |
| designer-curtains-50..> | 2025-05-08 17:58 | 23K | |
| download (1).jpeg | 2025-05-07 16:54 | 6.8K | |
| download (2).jpeg | 2025-05-07 16:56 | 12K | |
| download (3).jpeg | 2025-05-07 16:56 | 3.7K | |
| download (4).jpeg | 2025-05-20 16:22 | 10K | |
| download.jpeg | 2025-05-07 17:13 | 11K | |
| download.jpg | 2025-05-08 13:54 | 9.1K | |
| dupatta1.jpg | 2025-05-21 12:54 | 11K | |
| ethentic wear.webp | 2025-05-08 18:59 | 59K | |
| ethnic 1.webp | 2025-05-08 19:04 | 5.8K | |
| ethnic2.jpg | 2025-05-08 19:06 | 11K | |
| ethnic4.webp | 2025-05-08 19:05 | 7.3K | |
| exercise mat.jpeg | 2025-05-22 16:46 | 8.6K | |
| eye shadow 2.jpg | 2025-05-22 13:18 | 7.0K | |
| fabrics-best-fabric-..> | 2025-05-08 17:56 | 62K | |
| face cleaner 3.jpg | 2025-05-22 15:36 | 6.9K | |
| fancy_lehenga.png | 2025-05-21 13:56 | 86K | |
| formal.jpg | 2025-05-21 11:43 | 6.1K | |
| formal1.jpg | 2025-05-21 11:39 | 7.0K | |
| formal3.jpg | 2025-05-21 11:41 | 3.7K | |
| foundation1.jpg | 2025-05-22 13:12 | 8.0K | |
| girls swim 3.jpg | 2025-05-22 16:14 | 5.4K | |
| gloss 2.jpg | 2025-05-22 13:57 | 4.5K | |
| gym1_exact_421x481.jpg | 2025-05-20 13:56 | 32K | |
| highlighter 4.jpg | 2025-05-22 12:35 | 6.7K | |
| images.jpg | 2025-05-10 13:28 | 4.8K | |
| infact 1.jpg | 2025-05-09 15:13 | 7.2K | |
| infact2.jpg | 2025-05-09 13:12 | 3.8K | |
| infact3.jpg | 2025-05-09 13:13 | 8.3K | |
| infant4.jpg | 2025-05-09 13:14 | 8.6K | |
| innerwear.png | 2025-05-21 15:36 | 48K | |
| jeans1.jpg | 2025-05-09 12:33 | 3.8K | |
| jeans3.jpg | 2025-05-09 12:30 | 6.4K | |
| jeans4.jpg | 2025-05-09 12:29 | 4.8K | |
| jenas2.jpg | 2025-05-09 12:32 | 9.2K | |
| ki.jpg | 2025-05-08 18:24 | 165K | |
| kick board.jpeg | 2025-05-10 11:39 | 8.5K | |
| kick board 2.jpg | 2025-05-22 17:03 | 11K | |
| kueta2.jpg | 2025-05-20 17:05 | 4.4K | |
| kurta.png | 2025-05-20 17:07 | 59K | |
| kurta3.jpg | 2025-05-10 13:18 | 5.5K | |
| lehenga 1.png | 2025-05-21 13:51 | 90K | |
| lehenga2.png | 2025-05-21 14:01 | 77K | |
| lehenga3.png | 2025-05-21 13:53 | 81K | |
| lipbam 3.jpg | 2025-05-22 14:06 | 5.4K | |
| liptiic liner3.jpeg | 2025-05-22 14:29 | 2.2K | |
| liq liptic 1.jpg | 2025-05-22 14:25 | 4.8K | |
| liquid & lipstick.png | 2025-05-21 15:51 | 14K | |
| makup remove 2.jpg | 2025-05-21 16:53 | 3.3K | |
| mascara 1.jpg | 2025-05-22 13:29 | 7.5K | |
| mat 2.jpg | 2025-05-22 15:45 | 5.6K | |
| mat 3.jpg | 2025-05-10 12:04 | 12K | |
| mens.jpeg | 2025-05-21 11:30 | 9.0K | |
| mens1.jpg | 2025-05-21 11:31 | 8.1K | |
| mens2.jpeg | 2025-05-21 11:26 | 2.4K | |
| mens innerwear.jpg | 2025-05-21 11:35 | 4.4K | |
| men swimming costum..> | 2025-05-21 11:22 | 7.8K | |
| moisturizer4.jpg | 2025-05-10 12:32 | 5.3K | |
| mosquite3.jpg | 2025-05-08 13:02 | 4.8K | |
| mosquite4.jpg | 2025-05-08 12:50 | 6.8K | |
| nail removal 4.jpg | 2025-05-21 16:25 | 5.7K | |
| p1.png | 2025-05-21 13:38 | 40K | |
| p2.png | 2025-05-21 13:35 | 59K | |
| p3.jpeg | 2025-05-21 13:33 | 4.0K | |
| p4.jpg | 2025-05-10 12:59 | 4.1K | |
| patieyla 2.jpg | 2025-05-21 12:41 | 15K | |
| patiyla.jpeg | 2025-05-21 12:37 | 7.7K | |
| patiyla paent.jpeg | 2025-05-21 12:38 | 6.5K | |
| pexels-pixabay-33045..> | 2025-05-07 17:31 | 1.3M | |
| primer 4.jpg | 2025-05-10 12:29 | 3.4K | |
| rain-coat.jpg | 2025-05-20 16:28 | 4.4K | |
| raincoat1.jpg | 2025-05-10 13:19 | 4.8K | |
| raincoat3.jpg | 2025-05-20 16:30 | 7.3K | |
| raincooat2.jpg | 2025-05-20 16:33 | 5.2K | |
| s1.png | 2025-05-10 12:54 | 35K | |
| s2.png | 2025-05-21 14:26 | 52K | |
| s3.png | 2025-05-21 14:28 | 75K | |
| s4.png | 2025-05-21 14:30 | 83K | |
| serum.png | 2025-05-21 17:53 | 25K | |
| shopping (1).webp | 2025-05-08 13:25 | 11K | |
| shopping (2).webp | 2025-05-20 16:19 | 7.1K | |
| shopping.webp | 2025-05-08 13:34 | 29K | |
| short.jpeg | 2025-05-08 18:26 | 8.1K | |
| single-bed-fine-qual..> | 2025-05-08 13:24 | 118K | |
| squire-11.png | 2025-05-08 18:39 | 166K | |
| squire-12.png | 2025-05-08 18:18 | 85K | |
| squire-26.png | 2025-05-08 18:19 | 642K | |
| squire-29.png | 2025-05-10 12:53 | 76K | |
| squire-36.png | 2025-05-08 18:21 | 596K | |
| sun protection 2.jpg | 2025-05-21 17:10 | 6.8K | |
| swim boys 3.jpg | 2025-05-22 16:21 | 9.2K | |
| swim boys 4.jpg | 2025-05-22 16:16 | 4.8K | |
| swim cap 3.jpg | 2025-05-22 17:05 | 7.4K | |
| swim cap 4.jpg | 2025-05-22 16:33 | 8.1K | |
| swim girls 1.jpg | 2025-05-10 11:48 | 4.4K | |
| swimming cap2.jpg | 2025-05-10 11:37 | 4.7K | |
| swim ring 1.jpg | 2025-05-22 16:52 | 11K | |
| swim ring 2.jpg | 2025-05-10 12:00 | 10K | |
| swim ring 4.jpg | 2025-05-22 16:01 | 15K | |
| swim women 1.jpg | 2025-05-22 16:23 | 5.8K | |
| swim women 2.jpg | 2025-05-10 11:41 | 6.0K | |
| swim women 3.jpg | 2025-05-22 16:57 | 4.4K | |
| swim women 4.jpg | 2025-05-22 17:01 | 5.2K | |
| t-shirt.png | 2025-05-10 13:10 | 18K | |
| t-shirt0.1.png | 2025-05-20 18:46 | 18K | |
| track1.webp | 2025-05-09 12:28 | 4.6K | |
| track2.webp | 2025-05-09 12:27 | 4.6K | |
| track3.webp | 2025-05-08 19:08 | 2.1K | |
| track4.webp | 2025-05-08 19:10 | 2.4K | |
| tshirt1.jpg | 2025-05-20 18:43 | 4.8K | |
| tshrit3.jpg | 2025-05-20 18:48 | 5.8K | |
| tshrit4.jpeg | 2025-05-08 18:36 | 2.9K | |
| wedding-blouse.jpg | 2025-05-21 13:02 | 40K | |
| windcheter.jpg | 2025-05-20 18:09 | 5.2K | |
| windcheter0.1.jpg | 2025-05-20 18:21 | 6.3K | |
| windcheter3.jpg | 2025-05-20 17:19 | 6.3K | |
| windcheter4.jpg | 2025-05-20 18:14 | 5.1K | |
| windcheter5.jpg | 2025-05-20 17:17 | 5.5K | |
| windcheteres.jpg | 2025-05-20 18:17 | 6.3K | |
| winter1.jpg | 2025-05-10 13:02 | 6.4K | |
| winter2.jpg | 2025-05-21 12:18 | 5.7K | |
| winter4.jpg | 2025-05-21 12:26 | 8.7K | |
| winter7.jpg | 2025-05-21 12:29 | 8.5K | |
| winter men1.jpg | 2025-05-20 16:14 | 9.1K | |
| winter men3.jpg | 2025-05-20 16:05 | 9.6K | |
| winter men4.jpg | 2025-05-10 13:20 | 6.5K | |
| women.png | 2025-05-21 14:24 | 52K | |
